C22H36F2O4 — CID 173455504
7-[(1R,2R)-2-(difluoromethyl)-2-(3-hydroxy-3-methyloctyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 173455504) has the molecular formula C22H36F2O4 and a molecular weight of 402.52 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(difluoromethyl)-2-(3-hydroxy-3-methyloctyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-(difluoromethyl)-2-(3-hydroxy-3-methyloctyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 173455504 |
| Molecular Formula | C22H36F2O4 |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 7-[(1R,2R)-2-(difluoromethyl)-2-(3-hydroxy-3-methyloctyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(C)(O)CC[C@@]1(C(F)F)CCC(=O)[C@@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C22H36F2O4/c1-3-4-9-13-21(2,28)15-16-22(20(23)24)14-12-18(25)17(22)10-7-5-6-8-11-19(26)27/h5,7,17,20,28H,3-4,6,8-16H2,1-2H3,(H,26,27)/t17-,21?,22-/m0/s1 |
| InChIKey | CFNWCTGSFNOTAP-OWHMDLSXSA-N |
| XLogP | 5.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|