C22H40O5 — CID 129291322
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(4S)-4-hydroxy-4-methylnonan-2-yl]cyclopentyl]hept-5-enoic acid (PubChem CID 129291322) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(4S)-4-hydroxy-4-methylnonan-2-yl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(4S)-4-hydroxy-4-methylnonan-2-yl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 129291322 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(4S)-4-hydroxy-4-methylnonan-2-yl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC[C@](C)(O)CC(C)[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H40O5/c1-4-5-10-13-22(3,27)15-16(2)21-17(18(23)14-19(21)24)11-8-6-7-9-12-20(25)26/h6,8,16-19,21,23-24,27H,4-5,7,9-15H2,1-3H3,(H,25,26)/b8-6-/t16?,17-,18-,19+,21+,22-/m0/s1 |
| InChIKey | KMSLQAXZWZULNP-MANIYFMTSA-N |
| XLogP | 3.90 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|