C27H42O3Si — CID 140673256
1-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-3,3a,4,9-tetrahydrocyclopenta[b]naphthalen-2-one (PubChem CID 140673256) has the molecular formula C27H42O3Si and a molecular weight of 442.72 g/mol. Its IUPAC name is 1-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-3,3a,4,9-tetrahydrocyclopenta[b]naphthalen-2-one.
| Compound Name | 1-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-3,3a,4,9-tetrahydrocyclopenta[b]naphthalen-2-one |
|---|---|
| PubChem CID | 140673256 |
| Molecular Formula | C27H42O3Si |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 1-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-3,3a,4,9-tetrahydrocyclopenta[b]naphthalen-2-one |
| SMILES | CCCCC[C@@H](CCC1=C2Cc3cccc(O)c3CC2CC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H42O3Si/c1-7-8-9-12-21(30-31(5,6)27(2,3)4)14-15-22-23-16-19-11-10-13-25(28)24(19)17-20(23)18-26(22)29/h10-11,13,20-21,28H,7-9,12,14-18H2,1-6H3/t20?,21-/m0/s1 |
| InChIKey | MTNISHFXRVWWIV-LBAQZLPGSA-N |
| XLogP | 7.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|