C26H44O4Si — CID 70389911
(Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylpropyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 70389911) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylpropyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylpropyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70389911 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylpropyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1=CCC(=O)[C@@H]1C/C=C\CCCC(=O)O)C1CCCC1 |
| InChI | InChI=1S/C26H44O4Si/c1-26(2,3)31(4,5)30-24(21-12-10-11-13-21)19-17-20-16-18-23(27)22(20)14-8-6-7-9-15-25(28)29/h6,8,16,21-22,24H,7,9-15,17-19H2,1-5H3,(H,28,29)/b8-6-/t22-,24?/m1/s1 |
| InChIKey | SRPXFZDARLILHC-BNGJHLRLSA-N |
| XLogP | 7.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|