C28H50O4Si — CID 70389384
(Z)-7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-hydroxy-1-methylcyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 70389384) has the molecular formula C28H50O4Si and a molecular weight of 478.79 g/mol. Its IUPAC name is (Z)-7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-hydroxy-1-methylcyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-hydroxy-1-methylcyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70389384 |
| Molecular Formula | C28H50O4Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | (Z)-7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-hydroxy-1-methylcyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1=CC[C@H](O)[C@]1(C)C/C=C\CCCC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C28H50O4Si/c1-27(2,3)33(5,6)32-24(22-14-10-9-11-15-22)19-17-23-18-20-25(29)28(23,4)21-13-8-7-12-16-26(30)31/h8,13,18,22,24-25,29H,7,9-12,14-17,19-21H2,1-6H3,(H,30,31)/b13-8-/t24?,25-,28+/m0/s1 |
| InChIKey | RPBNZVWZVYYIDG-DEUVHJAMSA-N |
| XLogP | 7.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|