C23H28ClNO4 — CID 66693067
7-[(1R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-oxocyclopent-2-en-1-yl]-N-methylhept-5-enamide (PubChem CID 66693067) has the molecular formula C23H28ClNO4 and a molecular weight of 417.93 g/mol. Its IUPAC name is 7-[(1R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-oxocyclopent-2-en-1-yl]-N-methylhept-5-enamide.
| Compound Name | 7-[(1R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-oxocyclopent-2-en-1-yl]-N-methylhept-5-enamide |
|---|---|
| PubChem CID | 66693067 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 7-[(1R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-oxocyclopent-2-en-1-yl]-N-methylhept-5-enamide |
| SMILES | CNC(=O)CCCC=CC[C@H]1C(=O)CC=C1C=C[C@@H](O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H28ClNO4/c1-25-23(28)10-5-3-2-4-9-21-17(12-14-22(21)27)11-13-19(26)16-29-20-8-6-7-18(24)15-20/h2,4,6-8,11-13,15,19,21,26H,3,5,9-10,14,16H2,1H3,(H,25,28)/t19-,21-/m1/s1 |
| InChIKey | WEXMMVHOTIKPLU-TZIWHRDSSA-N |
| XLogP | 4.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|