C25H31ClO5 — CID 68604872
propan-2-yl 7-[(5S)-5-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 68604872) has the molecular formula C25H31ClO5 and a molecular weight of 446.97 g/mol. Its IUPAC name is propan-2-yl 7-[(5S)-5-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(5S)-5-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 68604872 |
| Molecular Formula | C25H31ClO5 |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | propan-2-yl 7-[(5S)-5-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CCC1C=CC(=O)[C@H]1C=C[C@@H](O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H31ClO5/c1-18(2)31-25(29)11-6-4-3-5-8-19-12-15-24(28)23(19)14-13-21(27)17-30-22-10-7-9-20(26)16-22/h3,5,7,9-10,12-16,18-19,21,23,27H,4,6,8,11,17H2,1-2H3/t19?,21-,23+/m1/s1 |
| InChIKey | PBNZYCJZFQMZPL-LVPCDLKWSA-N |
| XLogP | 5.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|