C24H31ClO6 — CID 59107221
propan-2-yl (Z)-7-[(3S,4R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-ynyl]-4-hydroxyoxolan-3-yl]hept-5-enoate (PubChem CID 59107221) has the molecular formula C24H31ClO6 and a molecular weight of 450.96 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(3S,4R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-ynyl]-4-hydroxyoxolan-3-yl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(3S,4R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-ynyl]-4-hydroxyoxolan-3-yl]hept-5-enoate |
|---|---|
| PubChem CID | 59107221 |
| Molecular Formula | C24H31ClO6 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | propan-2-yl (Z)-7-[(3S,4R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-ynyl]-4-hydroxyoxolan-3-yl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1C(C#C[C@@H](O)COc2cccc(Cl)c2)OC[C@@H]1O |
| InChI | InChI=1S/C24H31ClO6/c1-17(2)31-24(28)11-6-4-3-5-10-21-22(27)16-30-23(21)13-12-19(26)15-29-20-9-7-8-18(25)14-20/h3,5,7-9,14,17,19,21-23,26-27H,4,6,10-11,15-16H2,1-2H3/b5-3-/t19-,21+,22+,23?/m1/s1 |
| InChIKey | WPATWFLFVJPNNY-LVIDXGSPSA-N |
| XLogP | 3.53 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|