C24H33ClO6 — CID 90826277
propan-2-yl 7-[(2R,3S,4R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-4-hydroxyoxolan-3-yl]hept-4-enoate (PubChem CID 90826277) has the molecular formula C24H33ClO6 and a molecular weight of 452.98 g/mol. Its IUPAC name is propan-2-yl 7-[(2R,3S,4R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-4-hydroxyoxolan-3-yl]hept-4-enoate.
| Compound Name | propan-2-yl 7-[(2R,3S,4R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-4-hydroxyoxolan-3-yl]hept-4-enoate |
|---|---|
| PubChem CID | 90826277 |
| Molecular Formula | C24H33ClO6 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | propan-2-yl 7-[(2R,3S,4R)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-4-hydroxyoxolan-3-yl]hept-4-enoate |
| SMILES | CC(C)OC(=O)CCC=CCC[C@H]1[C@@H](O)CO[C@@H]1C=C[C@@H](O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H33ClO6/c1-17(2)31-24(28)11-6-4-3-5-10-21-22(27)16-30-23(21)13-12-19(26)15-29-20-9-7-8-18(25)14-20/h3-4,7-9,12-14,17,19,21-23,26-27H,5-6,10-11,15-16H2,1-2H3/t19-,21+,22+,23-/m1/s1 |
| InChIKey | IMMLEBMPKJECHF-YPIGPJMWSA-N |
| XLogP | 4.08 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|