C24H33ClO7 — CID 91163340
propan-2-yl 2-[4-[(1R,2R)-2-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]but-2-enoxy]acetate (PubChem CID 91163340) has the molecular formula C24H33ClO7 and a molecular weight of 468.97 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(1R,2R)-2-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]but-2-enoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(1R,2R)-2-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]but-2-enoxy]acetate |
|---|---|
| PubChem CID | 91163340 |
| Molecular Formula | C24H33ClO7 |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | propan-2-yl 2-[4-[(1R,2R)-2-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]but-2-enoxy]acetate |
| SMILES | CC(C)OC(=O)COCC=CC[C@H]1C(O)CC(O)[C@@H]1C=CC(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H33ClO7/c1-16(2)32-24(29)15-30-11-4-3-8-20-21(23(28)13-22(20)27)10-9-18(26)14-31-19-7-5-6-17(25)12-19/h3-7,9-10,12,16,18,20-23,26-28H,8,11,13-15H2,1-2H3/t18?,20-,21-,22?,23?/m1/s1 |
| InChIKey | PXUZCMBAFZTLFS-IFYHHEGISA-N |
| XLogP | 2.91 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|