C27H43ClO4Si — CID 59096175
(5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-chlorophenoxy)but-1-enyl]-4-[(Z)-hept-3-enyl]oxolan-3-ol (PubChem CID 59096175) has the molecular formula C27H43ClO4Si and a molecular weight of 495.18 g/mol. Its IUPAC name is (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-chlorophenoxy)but-1-enyl]-4-[(Z)-hept-3-enyl]oxolan-3-ol.
| Compound Name | (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-chlorophenoxy)but-1-enyl]-4-[(Z)-hept-3-enyl]oxolan-3-ol |
|---|---|
| PubChem CID | 59096175 |
| Molecular Formula | C27H43ClO4Si |
| Molecular Weight | 495.18 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (5R)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3-chlorophenoxy)but-1-enyl]-4-[(Z)-hept-3-enyl]oxolan-3-ol |
| SMILES | CCC/C=C\CCC1C(O)CO[C@@H]1/C=C/C(COc1cccc(Cl)c1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H43ClO4Si/c1-7-8-9-10-11-15-24-25(29)20-31-26(24)17-16-23(32-33(5,6)27(2,3)4)19-30-22-14-12-13-21(28)18-22/h9-10,12-14,16-18,23-26,29H,7-8,11,15,19-20H2,1-6H3/b10-9-,17-16+/t23?,24?,25?,26-/m1/s1 |
| InChIKey | DVCSHJYJIAKLOU-KWCNCBBXSA-N |
| XLogP | 7.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.18 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|