C23H33FO3 — CID 22951145
4-fluoro-2-[(E)-hept-3-enyl]-3-[(E)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]cyclopentan-1-ol (PubChem CID 22951145) has the molecular formula C23H33FO3 and a molecular weight of 376.51 g/mol. Its IUPAC name is 4-fluoro-2-[(E)-hept-3-enyl]-3-[(E)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]cyclopentan-1-ol.
| Compound Name | 4-fluoro-2-[(E)-hept-3-enyl]-3-[(E)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 22951145 |
| Molecular Formula | C23H33FO3 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 4-fluoro-2-[(E)-hept-3-enyl]-3-[(E)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]cyclopentan-1-ol |
| SMILES | CCC/C=C/CCC1C(O)CC(F)C1/C=C/C(O)COc1cccc(C)c1 |
| InChI | InChI=1S/C23H33FO3/c1-3-4-5-6-7-11-21-20(22(24)15-23(21)26)13-12-18(25)16-27-19-10-8-9-17(2)14-19/h5-6,8-10,12-14,18,20-23,25-26H,3-4,7,11,15-16H2,1-2H3/b6-5+,13-12+ |
| InChIKey | VTRBBRAXTJESNF-LHELVOSYSA-N |
| XLogP | 4.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|