C22H33NO3 — CID 59951921
(3R,4R,5R)-4-[(Z)-hept-2-enyl]-5-[(E,3R)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]pyrrolidin-3-ol (PubChem CID 59951921) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (3R,4R,5R)-4-[(Z)-hept-2-enyl]-5-[(E,3R)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]pyrrolidin-3-ol.
| Compound Name | (3R,4R,5R)-4-[(Z)-hept-2-enyl]-5-[(E,3R)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 59951921 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (3R,4R,5R)-4-[(Z)-hept-2-enyl]-5-[(E,3R)-3-hydroxy-4-(3-methylphenoxy)but-1-enyl]pyrrolidin-3-ol |
| SMILES | CCCC/C=C\C[C@H]1[C@@H](O)CN[C@@H]1/C=C/[C@@H](O)COc1cccc(C)c1 |
| InChI | InChI=1S/C22H33NO3/c1-3-4-5-6-7-11-20-21(23-15-22(20)25)13-12-18(24)16-26-19-10-8-9-17(2)14-19/h6-10,12-14,18,20-25H,3-5,11,15-16H2,1-2H3/b7-6-,13-12+/t18-,20-,21-,22+/m1/s1 |
| InChIKey | SHNXWKNTWHVOAX-AJLJIUBZSA-N |
| XLogP | 3.38 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|