C23H39BrO5Si — CID 14894506
methyl (Z)-2-bromo-4-[(1R,2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]but-2-enoate (PubChem CID 14894506) has the molecular formula C23H39BrO5Si and a molecular weight of 503.55 g/mol. Its IUPAC name is methyl (Z)-2-bromo-4-[(1R,2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]but-2-enoate.
| Compound Name | methyl (Z)-2-bromo-4-[(1R,2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]but-2-enoate |
|---|---|
| PubChem CID | 14894506 |
| Molecular Formula | C23H39BrO5Si |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | methyl (Z)-2-bromo-4-[(1R,2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylidene-3-(oxan-2-yloxy)cyclopentyl]but-2-enoate |
| SMILES | C=C1C[C@@H](OC2CCCCO2)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1C/C=C(\Br)C(=O)OC |
| InChI | InChI=1S/C23H39BrO5Si/c1-16-14-20(29-21-10-8-9-13-27-21)18(15-28-30(6,7)23(2,3)4)17(16)11-12-19(24)22(25)26-5/h12,17-18,20-21H,1,8-11,13-15H2,2-7H3/b19-12-/t17-,18+,20+,21?/m0/s1 |
| InChIKey | ZASSKIWCPDKSBJ-OYJXJPKDSA-N |
| XLogP | 5.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|