C43H52O5Si — CID 14674954
(4aR,5S,6R,7aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(oxan-2-yloxy)-7a-[(4-phenylphenyl)methyl]-3,4,4a,5,6,7-hexahydro-1H-cyclopenta[c]pyran-3-ol (PubChem CID 14674954) has the molecular formula C43H52O5Si and a molecular weight of 676.97 g/mol. Its IUPAC name is (4aR,5S,6R,7aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(oxan-2-yloxy)-7a-[(4-phenylphenyl)methyl]-3,4,4a,5,6,7-hexahydro-1H-cyclopenta[c]pyran-3-ol.
| Compound Name | (4aR,5S,6R,7aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(oxan-2-yloxy)-7a-[(4-phenylphenyl)methyl]-3,4,4a,5,6,7-hexahydro-1H-cyclopenta[c]pyran-3-ol |
|---|---|
| PubChem CID | 14674954 |
| Molecular Formula | C43H52O5Si |
| Molecular Weight | 676.97 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | (4aR,5S,6R,7aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(oxan-2-yloxy)-7a-[(4-phenylphenyl)methyl]-3,4,4a,5,6,7-hexahydro-1H-cyclopenta[c]pyran-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@H]2CC(O)OC[C@@]2(Cc2ccc(-c3ccccc3)cc2)C[C@H]1OC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H52O5Si/c1-42(2,3)49(35-17-9-5-10-18-35,36-19-11-6-12-20-36)47-30-37-38-27-40(44)46-31-43(38,29-39(37)48-41-21-13-14-26-45-41)28-32-22-24-34(25-23-32)33-15-7-4-8-16-33/h4-12,15-20,22-25,37-41,44H,13-14,21,26-31H2,1-3H3/t37-,38-,39-,40?,41?,43-/m1/s1 |
| InChIKey | FTOIPAINHUBRBM-FKMYOLNYSA-N |
| XLogP | 7.75 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.97 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|