C38H48O5Si — CID 173361462
(4aR,5S,6R,7aS)-5-(1-diphenylsilyloxy-2,2-dimethylpropyl)-6-(oxan-2-yloxy)-7a-(2-phenylethyl)-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-3-one (PubChem CID 173361462) has the molecular formula C38H48O5Si and a molecular weight of 612.88 g/mol. Its IUPAC name is (4aR,5S,6R,7aS)-5-(1-diphenylsilyloxy-2,2-dimethylpropyl)-6-(oxan-2-yloxy)-7a-(2-phenylethyl)-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-3-one.
| Compound Name | (4aR,5S,6R,7aS)-5-(1-diphenylsilyloxy-2,2-dimethylpropyl)-6-(oxan-2-yloxy)-7a-(2-phenylethyl)-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 173361462 |
| Molecular Formula | C38H48O5Si |
| Molecular Weight | 612.88 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | (4aR,5S,6R,7aS)-5-(1-diphenylsilyloxy-2,2-dimethylpropyl)-6-(oxan-2-yloxy)-7a-(2-phenylethyl)-1,4,4a,5,6,7-hexahydrocyclopenta[c]pyran-3-one |
| SMILES | CC(C)(C)C(O[SiH](c1ccccc1)c1ccccc1)[C@H]1[C@H]2CC(=O)OC[C@@]2(CCc2ccccc2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C38H48O5Si/c1-37(2,3)36(43-44(29-17-9-5-10-18-29)30-19-11-6-12-20-30)35-31-25-33(39)41-27-38(31,23-22-28-15-7-4-8-16-28)26-32(35)42-34-21-13-14-24-40-34/h4-12,15-20,31-32,34-36,44H,13-14,21-27H2,1-3H3/t31-,32-,34?,35+,36?,38-/m1/s1 |
| InChIKey | CJRZWDYVZGNINM-NZGKVNLMSA-N |
| XLogP | 6.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.88 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|