C37H46O4Si — CID 173361327
(3aR,4S,5R,6aR)-6a-benzyl-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-5-(oxan-2-yloxy)-1,3,3a,4,5,6-hexahydropentalen-2-one (PubChem CID 173361327) has the molecular formula C37H46O4Si and a molecular weight of 582.86 g/mol. Its IUPAC name is (3aR,4S,5R,6aR)-6a-benzyl-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-5-(oxan-2-yloxy)-1,3,3a,4,5,6-hexahydropentalen-2-one.
| Compound Name | (3aR,4S,5R,6aR)-6a-benzyl-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-5-(oxan-2-yloxy)-1,3,3a,4,5,6-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 173361327 |
| Molecular Formula | C37H46O4Si |
| Molecular Weight | 582.86 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | (3aR,4S,5R,6aR)-6a-benzyl-4-(1-diphenylsilyloxy-2,2-dimethylpropyl)-5-(oxan-2-yloxy)-1,3,3a,4,5,6-hexahydropentalen-2-one |
| SMILES | CC(C)(C)C(O[SiH](c1ccccc1)c1ccccc1)[C@H]1[C@H]2CC(=O)C[C@@]2(Cc2ccccc2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C37H46O4Si/c1-36(2,3)35(41-42(29-17-9-5-10-18-29)30-19-11-6-12-20-30)34-31-23-28(38)25-37(31,24-27-15-7-4-8-16-27)26-32(34)40-33-21-13-14-22-39-33/h4-12,15-20,31-35,42H,13-14,21-26H2,1-3H3/t31-,32-,33?,34+,35?,37+/m1/s1 |
| InChIKey | MUHMWTLFRZDWGA-CEKRGRQJSA-N |
| XLogP | 6.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.86 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|