C14H26O4 — CID 57239627
(5S)-7-hydroxy-4,4-dimethyl-5-(oxan-2-yloxy)heptan-3-one (PubChem CID 57239627) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (5S)-7-hydroxy-4,4-dimethyl-5-(oxan-2-yloxy)heptan-3-one.
| Compound Name | (5S)-7-hydroxy-4,4-dimethyl-5-(oxan-2-yloxy)heptan-3-one |
|---|---|
| PubChem CID | 57239627 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (5S)-7-hydroxy-4,4-dimethyl-5-(oxan-2-yloxy)heptan-3-one |
| SMILES | CCC(=O)C(C)(C)[C@H](CCO)OC1CCCCO1 |
| InChI | InChI=1S/C14H26O4/c1-4-11(16)14(2,3)12(8-9-15)18-13-7-5-6-10-17-13/h12-13,15H,4-10H2,1-3H3/t12-,13?/m0/s1 |
| InChIKey | QQIANTRKYMQYCW-UEWDXFNNSA-N |
| XLogP | 2.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |