C45H44O3Si2 — CID 15400444
[(E)-4-(oxan-2-yloxy)-3-triphenylsilylbut-2-enoxy]-triphenylsilane (PubChem CID 15400444) has the molecular formula C45H44O3Si2 and a molecular weight of 689.02 g/mol. Its IUPAC name is [(E)-4-(oxan-2-yloxy)-3-triphenylsilylbut-2-enoxy]-triphenylsilane.
| Compound Name | [(E)-4-(oxan-2-yloxy)-3-triphenylsilylbut-2-enoxy]-triphenylsilane |
|---|---|
| PubChem CID | 15400444 |
| Molecular Formula | C45H44O3Si2 |
| Molecular Weight | 689.02 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | [(E)-4-(oxan-2-yloxy)-3-triphenylsilylbut-2-enoxy]-triphenylsilane |
| SMILES | C(\CO[Si](c1ccccc1)(c1ccccc1)c1ccccc1)=C(\COC1CCCCO1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H44O3Si2/c1-7-21-38(22-8-1)49(39-23-9-2-10-24-39,40-25-11-3-12-26-40)44(37-47-45-33-19-20-35-46-45)34-36-48-50(41-27-13-4-14-28-41,42-29-15-5-16-30-42)43-31-17-6-18-32-43/h1-18,21-32,34,45H,19-20,33,35-37H2/b44-34+ |
| InChIKey | GDOZNGYWIVQXHF-WTCPEQCQSA-N |
| XLogP | 5.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.02 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|