C16H22O2 — CID 102509927
2-[(Z)-3-(2-methylphenyl)but-2-enoxy]oxane (PubChem CID 102509927) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-[(Z)-3-(2-methylphenyl)but-2-enoxy]oxane.
| Compound Name | 2-[(Z)-3-(2-methylphenyl)but-2-enoxy]oxane |
|---|---|
| PubChem CID | 102509927 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[(Z)-3-(2-methylphenyl)but-2-enoxy]oxane |
| SMILES | C/C(=C/COC1CCCCO1)c1ccccc1C |
| InChI | InChI=1S/C16H22O2/c1-13-7-3-4-8-15(13)14(2)10-12-18-16-9-5-6-11-17-16/h3-4,7-8,10,16H,5-6,9,11-12H2,1-2H3/b14-10- |
| InChIKey | CVJLBBSSXMMYFW-UVTDQMKNSA-N |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |