C19H32O2 — CID 102509937
2-[(E)-3-(4-tert-butylcyclohexen-1-yl)but-2-enoxy]oxane (PubChem CID 102509937) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-[(E)-3-(4-tert-butylcyclohexen-1-yl)but-2-enoxy]oxane.
| Compound Name | 2-[(E)-3-(4-tert-butylcyclohexen-1-yl)but-2-enoxy]oxane |
|---|---|
| PubChem CID | 102509937 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[(E)-3-(4-tert-butylcyclohexen-1-yl)but-2-enoxy]oxane |
| SMILES | C/C(=C\COC1CCCCO1)C1=CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H32O2/c1-15(12-14-21-18-7-5-6-13-20-18)16-8-10-17(11-9-16)19(2,3)4/h8,12,17-18H,5-7,9-11,13-14H2,1-4H3/b15-12+ |
| InChIKey | VJFJBZKANRCYNJ-NTCAYCPXSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |