C39H52O5Si — CID 56833322
[(E)-6-[(5S,6R)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-hydroxy-5-methyloxan-2-yl]-1-phenylhex-2-enyl] acetate (PubChem CID 56833322) has the molecular formula C39H52O5Si and a molecular weight of 628.93 g/mol. Its IUPAC name is [(E)-6-[(5S,6R)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-hydroxy-5-methyloxan-2-yl]-1-phenylhex-2-enyl] acetate.
| Compound Name | [(E)-6-[(5S,6R)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-hydroxy-5-methyloxan-2-yl]-1-phenylhex-2-enyl] acetate |
|---|---|
| PubChem CID | 56833322 |
| Molecular Formula | C39H52O5Si |
| Molecular Weight | 628.93 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | [(E)-6-[(5S,6R)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-hydroxy-5-methyloxan-2-yl]-1-phenylhex-2-enyl] acetate |
| SMILES | CC(=O)OC(/C=C/CCCC1(O)CC[C@H](C)[C@@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1)c1ccccc1 |
| InChI | InChI=1S/C39H52O5Si/c1-31-27-29-39(41,28-17-9-16-25-37(43-32(2)40)33-19-10-6-11-20-33)44-36(31)26-18-30-42-45(38(3,4)5,34-21-12-7-13-22-34)35-23-14-8-15-24-35/h6-8,10-16,19-25,31,36-37,41H,9,17-18,26-30H2,1-5H3/b25-16+/t31-,36+,37?,39?/m0/s1 |
| InChIKey | VGXGYJIQPHWIRV-ULCQQXDJSA-N |
| XLogP | 7.88 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.93 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|