C41H66O4Si2 — CID 11093648
(2Z,4E,6S,7S,10Z)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-methoxy-6,10-dimethyl-7-tri(propan-2-yl)silyloxydodeca-2,4,10-trien-1-ol (PubChem CID 11093648) has the molecular formula C41H66O4Si2 and a molecular weight of 679.15 g/mol. Its IUPAC name is (2Z,4E,6S,7S,10Z)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-methoxy-6,10-dimethyl-7-tri(propan-2-yl)silyloxydodeca-2,4,10-trien-1-ol.
| Compound Name | (2Z,4E,6S,7S,10Z)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-methoxy-6,10-dimethyl-7-tri(propan-2-yl)silyloxydodeca-2,4,10-trien-1-ol |
|---|---|
| PubChem CID | 11093648 |
| Molecular Formula | C41H66O4Si2 |
| Molecular Weight | 679.15 g/mol |
| Exact Mass | 678.45 |
| IUPAC Name | (2Z,4E,6S,7S,10Z)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-methoxy-6,10-dimethyl-7-tri(propan-2-yl)silyloxydodeca-2,4,10-trien-1-ol |
| SMILES | COC/C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)=C(\C)CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C/C=C\CO |
| InChI | InChI=1S/C41H66O4Si2/c1-32(2)46(33(3)4,34(5)6)45-40(36(8)22-16-15-21-29-42)28-27-35(7)37(30-43-12)31-44-47(41(9,10)11,38-23-17-13-18-24-38)39-25-19-14-20-26-39/h13-26,32-34,36,40,42H,27-31H2,1-12H3/b21-15-,22-16+,37-35-/t36-,40-/m0/s1 |
| InChIKey | MPZDYDGTQWURER-ZCJLLOFCSA-N |
| XLogP | 9.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.15 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|