C33H55BrOSiSn — CID 23727940
[(2R)-4-bromo-2-methyl-4-tributylstannylbutoxy]-tert-butyl-diphenylsilane (PubChem CID 23727940) has the molecular formula C33H55BrOSiSn and a molecular weight of 694.50 g/mol. Its IUPAC name is [(2R)-4-bromo-2-methyl-4-tributylstannylbutoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R)-4-bromo-2-methyl-4-tributylstannylbutoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 23727940 |
| Molecular Formula | C33H55BrOSiSn |
| Molecular Weight | 694.50 g/mol |
| Exact Mass | 694.22 |
| IUPAC Name | [(2R)-4-bromo-2-methyl-4-tributylstannylbutoxy]-tert-butyl-diphenylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(Br)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H28BrOSi.3C4H9.Sn/c1-18(15-16-22)17-23-24(21(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20;3*1-3-4-2;/h5-14,16,18H,15,17H2,1-4H3;3*1,3-4H2,2H3;/t18-;;;;/m1..../s1 |
| InChIKey | VSEQMEPIHVZZAC-HHVPYRKWSA-N |
| XLogP | 9.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.50 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|