C31H54O7Si — CID 11376494
(2S,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-2-[(E,4S)-4-methoxy-5-phenylmethoxypent-1-enyl]-3,5-dimethyloxan-4-ol (PubChem CID 11376494) has the molecular formula C31H54O7Si and a molecular weight of 566.85 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-2-[(E,4S)-4-methoxy-5-phenylmethoxypent-1-enyl]-3,5-dimethyloxan-4-ol.
| Compound Name | (2S,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-2-[(E,4S)-4-methoxy-5-phenylmethoxypent-1-enyl]-3,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 11376494 |
| Molecular Formula | C31H54O7Si |
| Molecular Weight | 566.85 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-2-[(E,4S)-4-methoxy-5-phenylmethoxypent-1-enyl]-3,5-dimethyloxan-4-ol |
| SMILES | COC[C@@H](C[C@H]1O[C@](/C=C/C[C@@H](COCc2ccccc2)OC)(OC)[C@H](C)[C@@H](O)[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H54O7Si/c1-23-28(19-27(21-33-6)38-39(9,10)30(3,4)5)37-31(35-8,24(2)29(23)32)18-14-17-26(34-7)22-36-20-25-15-12-11-13-16-25/h11-16,18,23-24,26-29,32H,17,19-22H2,1-10H3/b18-14+/t23-,24+,26-,27+,28+,29-,31-/m0/s1 |
| InChIKey | BOVSVXZYKWISRT-XAWNDOQOSA-N |
| XLogP | 5.97 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.85 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|