C21H33BClNO5 — CID 123556274
tert-butyl N-[1-[5-chloro-2-methoxy-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate (PubChem CID 123556274) has the molecular formula C21H33BClNO5 and a molecular weight of 425.76 g/mol. Its IUPAC name is tert-butyl N-[1-[5-chloro-2-methoxy-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[5-chloro-2-methoxy-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 123556274 |
| Molecular Formula | C21H33BClNO5 |
| Molecular Weight | 425.76 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | tert-butyl N-[1-[5-chloro-2-methoxy-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate |
| SMILES | COc1c(C(C)NC(=O)OC(C)(C)C)cc(Cl)c(C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H33BClNO5/c1-12-15(23)11-14(13(2)24-18(25)27-19(3,4)5)17(26-10)16(12)22-28-20(6,7)21(8,9)29-22/h11,13H,1-10H3,(H,24,25) |
| InChIKey | JEFNSLRJSULVLC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.76 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|