C18H28BNO5 — CID 150975173
butyl N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 150975173) has the molecular formula C18H28BNO5 and a molecular weight of 349.24 g/mol. Its IUPAC name is butyl N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | butyl N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 150975173 |
| Molecular Formula | C18H28BNO5 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | butyl N-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1OC |
| InChI | InChI=1S/C18H28BNO5/c1-7-8-11-23-16(21)20-14-10-9-13(12-15(14)22-6)19-24-17(2,3)18(4,5)25-19/h9-10,12H,7-8,11H2,1-6H3,(H,20,21) |
| InChIKey | LOYHQQNULHYNKA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|