C19H21ClF3N3O3 — CID 67364213
2-chloro-N-[4-[[5-(dihydroxymethyl)pyrazol-1-yl]methyl]cyclohexyl]-5-(trifluoromethyl)benzamide (PubChem CID 67364213) has the molecular formula C19H21ClF3N3O3 and a molecular weight of 431.84 g/mol. Its IUPAC name is 2-chloro-N-[4-[[5-(dihydroxymethyl)pyrazol-1-yl]methyl]cyclohexyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[4-[[5-(dihydroxymethyl)pyrazol-1-yl]methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67364213 |
| Molecular Formula | C19H21ClF3N3O3 |
| Molecular Weight | 431.84 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-chloro-N-[4-[[5-(dihydroxymethyl)pyrazol-1-yl]methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCC(Cn2nccc2C(O)O)CC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H21ClF3N3O3/c20-15-6-3-12(19(21,22)23)9-14(15)17(27)25-13-4-1-11(2-5-13)10-26-16(18(28)29)7-8-24-26/h3,6-9,11,13,18,28-29H,1-2,4-5,10H2,(H,25,27) |
| InChIKey | ICKQWPQJGGGMIQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|