C44H42Cl2F6N6O2 — CID 88911585
2-chloro-N-[4-(indazol-1-ylmethyl)cyclohexyl]-5-(trifluoromethyl)benzamide;2-chloro-N-[4-(indazol-2-ylmethyl)cyclohexyl]-5-(trifluoromethyl)benzamide (PubChem CID 88911585) has the molecular formula C44H42Cl2F6N6O2 and a molecular weight of 871.75 g/mol. Its IUPAC name is 2-chloro-N-[4-(indazol-1-ylmethyl)cyclohexyl]-5-(trifluoromethyl)benzamide;2-chloro-N-[4-(indazol-2-ylmethyl)cyclohexyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[4-(indazol-1-ylmethyl)cyclohexyl]-5-(trifluoromethyl)benzamide;2-chloro-N-[4-(indazol-2-ylmethyl)cyclohexyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 88911585 |
| Molecular Formula | C44H42Cl2F6N6O2 |
| Molecular Weight | 871.75 g/mol |
| Exact Mass | 870.27 |
| IUPAC Name | 2-chloro-N-[4-(indazol-1-ylmethyl)cyclohexyl]-5-(trifluoromethyl)benzamide;2-chloro-N-[4-(indazol-2-ylmethyl)cyclohexyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCC(Cn2cc3ccccc3n2)CC1)c1cc(C(F)(F)F)ccc1Cl.O=C(NC1CCC(Cn2ncc3ccccc32)CC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/2C22H21ClF3N3O/c23-19-10-7-16(22(24,25)26)11-18(19)21(30)28-17-8-5-14(6-9-17)13-29-20-4-2-1-3-15(20)12-27-29;23-19-10-7-16(22(24,25)26)11-18(19)21(30)27-17-8-5-14(6-9-17)12-29-13-15-3-1-2-4-20(15)28-29/h1-4,7,10-12,14,17H,5-6,8-9,13H2,(H,28,30);1-4,7,10-11,13-14,17H,5-6,8-9,12H2,(H,27,30) |
| InChIKey | AZPRAIORBLPGIG-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.75 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |