C19H21ClF3N3O — CID 58317484
2-chloro-N-[4-[(2H-pyrrol-5-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide (PubChem CID 58317484) has the molecular formula C19H21ClF3N3O and a molecular weight of 399.84 g/mol. Its IUPAC name is 2-chloro-N-[4-[(2H-pyrrol-5-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[4-[(2H-pyrrol-5-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58317484 |
| Molecular Formula | C19H21ClF3N3O |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-chloro-N-[4-[(2H-pyrrol-5-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCC(CNC2=NCC=C2)CC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H21ClF3N3O/c20-16-8-5-13(19(21,22)23)10-15(16)18(27)26-14-6-3-12(4-7-14)11-25-17-2-1-9-24-17/h1-2,5,8,10,12,14H,3-4,6-7,9,11H2,(H,24,25)(H,26,27) |
| InChIKey | QLXQQHUUZWEQET-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |