C18H24F3N3O3 — CID 16886734
N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 16886734) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 16886734 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | COCCN1CCC(CNC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H24F3N3O3/c1-27-10-9-24-7-5-13(6-8-24)12-22-16(25)17(26)23-15-4-2-3-14(11-15)18(19,20)21/h2-4,11,13H,5-10,12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | WFBAEZMLEWZLBG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|