C19H29N3O5 — CID 16886684
N'-(2,4-dimethoxyphenyl)-N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]oxamide (PubChem CID 16886684) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is N'-(2,4-dimethoxyphenyl)-N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2,4-dimethoxyphenyl)-N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 16886684 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N'-(2,4-dimethoxyphenyl)-N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]oxamide |
| SMILES | COCCN1CCC(CNC(=O)C(=O)Nc2ccc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C19H29N3O5/c1-25-11-10-22-8-6-14(7-9-22)13-20-18(23)19(24)21-16-5-4-15(26-2)12-17(16)27-3/h4-5,12,14H,6-11,13H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | CYWZORSKWJTTLC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|