C22H29ClN2O4 — CID 120769619
[(3R,4R)-1-[[6-(2-methoxyethoxy)-1,3-benzodioxol-5-yl]methyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120769619) has the molecular formula C22H29ClN2O4 and a molecular weight of 420.94 g/mol. Its IUPAC name is [(3R,4R)-1-[[6-(2-methoxyethoxy)-1,3-benzodioxol-5-yl]methyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [(3R,4R)-1-[[6-(2-methoxyethoxy)-1,3-benzodioxol-5-yl]methyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120769619 |
| Molecular Formula | C22H29ClN2O4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(3R,4R)-1-[[6-(2-methoxyethoxy)-1,3-benzodioxol-5-yl]methyl]-4-phenylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | COCCOc1cc2c(cc1CN1C[C@@H](CN)[C@H](c3ccccc3)C1)OCO2.Cl |
| InChI | InChI=1S/C22H28N2O4.ClH/c1-25-7-8-26-20-10-22-21(27-15-28-22)9-17(20)12-24-13-18(11-23)19(14-24)16-5-3-2-4-6-16;/h2-6,9-10,18-19H,7-8,11-15,23H2,1H3;1H/t18-,19+;/m1./s1 |
| InChIKey | GSJQCMJNXFOELC-VOMIJIAVSA-N |
| XLogP | 3.04 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|