C18H19F3N2 — CID 120769564
[(3R,4R)-4-phenyl-1-[(2,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]methanamine (PubChem CID 120769564) has the molecular formula C18H19F3N2 and a molecular weight of 320.36 g/mol. Its IUPAC name is [(3R,4R)-4-phenyl-1-[(2,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]methanamine.
| Compound Name | [(3R,4R)-4-phenyl-1-[(2,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120769564 |
| Molecular Formula | C18H19F3N2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [(3R,4R)-4-phenyl-1-[(2,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]methanamine |
| SMILES | NC[C@@H]1CN(Cc2cc(F)c(F)cc2F)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19F3N2/c19-16-7-18(21)17(20)6-13(16)9-23-10-14(8-22)15(11-23)12-4-2-1-3-5-12/h1-7,14-15H,8-11,22H2/t14-,15+/m1/s1 |
| InChIKey | MGWVFSIJAVRPGA-CABCVRRESA-N |
| XLogP | 3.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|