C17H18ClN3O2 — CID 120760519
(3S,4R)-1-[(2-chloro-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-amine (PubChem CID 120760519) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is (3S,4R)-1-[(2-chloro-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[(2-chloro-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120760519 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (3S,4R)-1-[(2-chloro-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(Cc2cc([N+](=O)[O-])ccc2Cl)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18ClN3O2/c18-16-7-6-14(21(22)23)8-13(16)9-20-10-15(17(19)11-20)12-4-2-1-3-5-12/h1-8,15,17H,9-11,19H2/t15-,17+/m0/s1 |
| InChIKey | NUEKZPQCGXQROZ-DOTOQJQBSA-N |
| XLogP | 3.17 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|