C12H13ClF2N2O2 — CID 171365172
1-[(2-chloro-5-nitrophenyl)methyl]-4,4-difluoropiperidine (PubChem CID 171365172) has the molecular formula C12H13ClF2N2O2 and a molecular weight of 290.70 g/mol. Its IUPAC name is 1-[(2-chloro-5-nitrophenyl)methyl]-4,4-difluoropiperidine.
| Compound Name | 1-[(2-chloro-5-nitrophenyl)methyl]-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 171365172 |
| Molecular Formula | C12H13ClF2N2O2 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1-[(2-chloro-5-nitrophenyl)methyl]-4,4-difluoropiperidine |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(CN2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C12H13ClF2N2O2/c13-11-2-1-10(17(18)19)7-9(11)8-16-5-3-12(14,15)4-6-16/h1-2,7H,3-6,8H2 |
| InChIKey | BCIQRLPIEDLMNW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|