C13H16ClN3O3 — CID 102848288
4-[(2-chloro-5-nitrophenyl)methyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 102848288) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 4-[(2-chloro-5-nitrophenyl)methyl]-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[(2-chloro-5-nitrophenyl)methyl]-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102848288 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-[(2-chloro-5-nitrophenyl)methyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(Cc2cc([N+](=O)[O-])ccc2Cl)CC1=O |
| InChI | InChI=1S/C13H16ClN3O3/c1-15-5-2-6-16(9-13(15)18)8-10-7-11(17(19)20)3-4-12(10)14/h3-4,7H,2,5-6,8-9H2,1H3 |
| InChIKey | XGEBGPJXORWHMT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|