C12H10ClN3O4 — CID 62929785
1-[(2-chloro-5-nitrophenyl)methyl]-4-methylpyrazine-2,3-dione (PubChem CID 62929785) has the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. Its IUPAC name is 1-[(2-chloro-5-nitrophenyl)methyl]-4-methylpyrazine-2,3-dione.
| Compound Name | 1-[(2-chloro-5-nitrophenyl)methyl]-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 62929785 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 1-[(2-chloro-5-nitrophenyl)methyl]-4-methylpyrazine-2,3-dione |
| SMILES | Cn1ccn(Cc2cc([N+](=O)[O-])ccc2Cl)c(=O)c1=O |
| InChI | InChI=1S/C12H10ClN3O4/c1-14-4-5-15(12(18)11(14)17)7-8-6-9(16(19)20)2-3-10(8)13/h2-6H,7H2,1H3 |
| InChIKey | NDTOIYSLJSMWFL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|