C15H14ClN5O4 — CID 26029399
4-[(2-chloro-5-nitrophenyl)methyl-methylamino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 26029399) has the molecular formula C15H14ClN5O4 and a molecular weight of 363.76 g/mol. Its IUPAC name is 4-[(2-chloro-5-nitrophenyl)methyl-methylamino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
| Compound Name | 4-[(2-chloro-5-nitrophenyl)methyl-methylamino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 26029399 |
| Molecular Formula | C15H14ClN5O4 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-[(2-chloro-5-nitrophenyl)methyl-methylamino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | CN(Cc1cc([N+](=O)[O-])ccc1Cl)c1c(C#N)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C15H14ClN5O4/c1-18(8-9-6-10(21(24)25)4-5-12(9)16)13-11(7-17)14(22)20(3)15(23)19(13)2/h4-6H,8H2,1-3H3 |
| InChIKey | FDEYMHOVNALHPB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 114.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|