C17H22Cl2N2O4 — CID 122022190
4-[[4-[(3,4-dichlorophenyl)methoxy]piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 122022190) has the molecular formula C17H22Cl2N2O4 and a molecular weight of 389.28 g/mol. Its IUPAC name is 4-[[4-[(3,4-dichlorophenyl)methoxy]piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-[(3,4-dichlorophenyl)methoxy]piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022190 |
| Molecular Formula | C17H22Cl2N2O4 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-[[4-[(3,4-dichlorophenyl)methoxy]piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCC(OCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O4/c18-14-4-3-12(10-15(14)19)11-25-13-5-8-21(9-6-13)17(24)20-7-1-2-16(22)23/h3-4,10,13H,1-2,5-9,11H2,(H,20,24)(H,22,23) |
| InChIKey | GRHWSUXRIRMDJK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|