C16H17Cl2N3O2 — CID 95174624
1-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-3-imidazol-1-ylpropan-1-one (PubChem CID 95174624) has the molecular formula C16H17Cl2N3O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is 1-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-3-imidazol-1-ylpropan-1-one.
| Compound Name | 1-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-3-imidazol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 95174624 |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-3-imidazol-1-ylpropan-1-one |
| SMILES | O=C(CCn1ccnc1)N1CCO[C@@H](c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H17Cl2N3O2/c17-13-2-1-12(9-14(13)18)15-10-21(7-8-23-15)16(22)3-5-20-6-4-19-11-20/h1-2,4,6,9,11,15H,3,5,7-8,10H2/t15-/m1/s1 |
| InChIKey | XSWINMLPMYSQCV-OAHLLOKOSA-N |
| XLogP | 3.18 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |