C20H33N4OS+ — CID 9213693
N-tert-butyl-2-[4-[(4-propan-2-ylphenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9213693) has the molecular formula C20H33N4OS+ and a molecular weight of 377.58 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[(4-propan-2-ylphenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[(4-propan-2-ylphenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9213693 |
| Molecular Formula | C20H33N4OS+ |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | N-tert-butyl-2-[4-[(4-propan-2-ylphenyl)carbamothioyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CC(C)c1ccc(NC(=S)N2CC[NH+](CC(=O)NC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H32N4OS/c1-15(2)16-6-8-17(9-7-16)21-19(26)24-12-10-23(11-13-24)14-18(25)22-20(3,4)5/h6-9,15H,10-14H2,1-5H3,(H,21,26)(H,22,25)/p+1 |
| InChIKey | RJOOUGROVVBQFQ-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|