C19H20F2N2O2S — CID 24617722
4-[[4-(difluoromethylsulfanyl)benzoyl]amino]-N,N-diethylbenzamide (PubChem CID 24617722) has the molecular formula C19H20F2N2O2S and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-[[4-(difluoromethylsulfanyl)benzoyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[4-(difluoromethylsulfanyl)benzoyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 24617722 |
| Molecular Formula | C19H20F2N2O2S |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-[[4-(difluoromethylsulfanyl)benzoyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H20F2N2O2S/c1-3-23(4-2)18(25)14-5-9-15(10-6-14)22-17(24)13-7-11-16(12-8-13)26-19(20)21/h5-12,19H,3-4H2,1-2H3,(H,22,24) |
| InChIKey | HLPKNGMJRWTOHU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |