C17H16BrCl3N2O — CID 58149556
4-bromo-N-[2,2-dichloro-1-(4-chloroanilino)butyl]benzamide (PubChem CID 58149556) has the molecular formula C17H16BrCl3N2O and a molecular weight of 450.59 g/mol. Its IUPAC name is 4-bromo-N-[2,2-dichloro-1-(4-chloroanilino)butyl]benzamide.
| Compound Name | 4-bromo-N-[2,2-dichloro-1-(4-chloroanilino)butyl]benzamide |
|---|---|
| PubChem CID | 58149556 |
| Molecular Formula | C17H16BrCl3N2O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 447.95 |
| IUPAC Name | 4-bromo-N-[2,2-dichloro-1-(4-chloroanilino)butyl]benzamide |
| SMILES | CCC(Cl)(Cl)C(NC(=O)c1ccc(Br)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16BrCl3N2O/c1-2-17(20,21)16(22-14-9-7-13(19)8-10-14)23-15(24)11-3-5-12(18)6-4-11/h3-10,16,22H,2H2,1H3,(H,23,24) |
| InChIKey | UGOLICWQCXWNQK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|