C16H14Cl3FN2O — CID 2843811
2-methyl-N-[2,2,2-trichloro-1-(2-fluoroanilino)ethyl]benzamide (PubChem CID 2843811) has the molecular formula C16H14Cl3FN2O and a molecular weight of 375.66 g/mol. Its IUPAC name is 2-methyl-N-[2,2,2-trichloro-1-(2-fluoroanilino)ethyl]benzamide.
| Compound Name | 2-methyl-N-[2,2,2-trichloro-1-(2-fluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 2843811 |
| Molecular Formula | C16H14Cl3FN2O |
| Molecular Weight | 375.66 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-methyl-N-[2,2,2-trichloro-1-(2-fluoroanilino)ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(Nc1ccccc1F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H14Cl3FN2O/c1-10-6-2-3-7-11(10)14(23)22-15(16(17,18)19)21-13-9-5-4-8-12(13)20/h2-9,15,21H,1H3,(H,22,23) |
| InChIKey | HDUFOEGJRYWJSQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|