C12H16Cl3N3O — CID 843404
1,1-dimethyl-3-[(1R)-2,2,2-trichloro-1-(2-methylanilino)ethyl]urea (PubChem CID 843404) has the molecular formula C12H16Cl3N3O and a molecular weight of 324.64 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(1R)-2,2,2-trichloro-1-(2-methylanilino)ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[(1R)-2,2,2-trichloro-1-(2-methylanilino)ethyl]urea |
|---|---|
| PubChem CID | 843404 |
| Molecular Formula | C12H16Cl3N3O |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1,1-dimethyl-3-[(1R)-2,2,2-trichloro-1-(2-methylanilino)ethyl]urea |
| SMILES | Cc1ccccc1N[C@H](NC(=O)N(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H16Cl3N3O/c1-8-6-4-5-7-9(8)16-10(12(13,14)15)17-11(19)18(2)3/h4-7,10,16H,1-3H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | WUCDVSDELVHDKG-SNVBAGLBSA-N |
| XLogP | 3.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|