C11H11Cl6N3O — CID 3090822
1,1-dimethyl-3-[2,2,2-trichloro-1-(2,4,6-trichloroanilino)ethyl]urea (PubChem CID 3090822) has the molecular formula C11H11Cl6N3O and a molecular weight of 413.95 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2,2,2-trichloro-1-(2,4,6-trichloroanilino)ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2,2,2-trichloro-1-(2,4,6-trichloroanilino)ethyl]urea |
|---|---|
| PubChem CID | 3090822 |
| Molecular Formula | C11H11Cl6N3O |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 410.90 |
| IUPAC Name | 1,1-dimethyl-3-[2,2,2-trichloro-1-(2,4,6-trichloroanilino)ethyl]urea |
| SMILES | CN(C)C(=O)NC(Nc1c(Cl)cc(Cl)cc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl6N3O/c1-20(2)10(21)19-9(11(15,16)17)18-8-6(13)3-5(12)4-7(8)14/h3-4,9,18H,1-2H3,(H,19,21) |
| InChIKey | DTNBUYWXXORPMR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|