C9H10Cl3N — CID 28992463
2,4,6-trichloro-N-propan-2-ylaniline (PubChem CID 28992463) has the molecular formula C9H10Cl3N and a molecular weight of 238.55 g/mol. Its IUPAC name is 2,4,6-trichloro-N-propan-2-ylaniline.
| Compound Name | 2,4,6-trichloro-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 28992463 |
| Molecular Formula | C9H10Cl3N |
| Molecular Weight | 238.55 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 2,4,6-trichloro-N-propan-2-ylaniline |
| SMILES | CC(C)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl3N/c1-5(2)13-9-7(11)3-6(10)4-8(9)12/h3-5,13H,1-2H3 |
| InChIKey | FQJBLIKGCVGDNM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |