C17H18Cl3N — CID 63425749
2,4,6-trichloro-N-(3-methyl-1-phenylbutyl)aniline (PubChem CID 63425749) has the molecular formula C17H18Cl3N and a molecular weight of 342.70 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(3-methyl-1-phenylbutyl)aniline.
| Compound Name | 2,4,6-trichloro-N-(3-methyl-1-phenylbutyl)aniline |
|---|---|
| PubChem CID | 63425749 |
| Molecular Formula | C17H18Cl3N |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2,4,6-trichloro-N-(3-methyl-1-phenylbutyl)aniline |
| SMILES | CC(C)CC(Nc1c(Cl)cc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H18Cl3N/c1-11(2)8-16(12-6-4-3-5-7-12)21-17-14(19)9-13(18)10-15(17)20/h3-7,9-11,16,21H,8H2,1-2H3 |
| InChIKey | NMQFDTOKSMHFIJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |