C12H13Cl5N4OS — CID 3091296
1,1-dimethyl-3-[2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]urea (PubChem CID 3091296) has the molecular formula C12H13Cl5N4OS and a molecular weight of 438.60 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]urea |
|---|---|
| PubChem CID | 3091296 |
| Molecular Formula | C12H13Cl5N4OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 435.93 |
| IUPAC Name | 1,1-dimethyl-3-[2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]urea |
| SMILES | CN(C)C(=O)NC(NC(=S)Nc1c(Cl)cccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl5N4OS/c1-21(2)11(22)20-9(12(15,16)17)19-10(23)18-8-6(13)4-3-5-7(8)14/h3-5,9H,1-2H3,(H,20,22)(H2,18,19,23) |
| InChIKey | LAEARUPEIPEWQE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|